C22H29NO2S — CID 122331404
2-(1-adamantyl)-1-[2-(4-methoxyphenyl)-1,3-thiazolidin-3-yl]ethanone (PubChem CID 122331404) has the molecular formula C22H29NO2S and a molecular weight of 371.55 g/mol. Its IUPAC name is 2-(1-adamantyl)-1-[2-(4-methoxyphenyl)-1,3-thiazolidin-3-yl]ethanone.
| Compound Name | 2-(1-adamantyl)-1-[2-(4-methoxyphenyl)-1,3-thiazolidin-3-yl]ethanone |
|---|---|
| PubChem CID | 122331404 |
| Molecular Formula | C22H29NO2S |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 2-(1-adamantyl)-1-[2-(4-methoxyphenyl)-1,3-thiazolidin-3-yl]ethanone |
| SMILES | COc1ccc(C2SCCN2C(=O)CC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C22H29NO2S/c1-25-19-4-2-18(3-5-19)21-23(6-7-26-21)20(24)14-22-11-15-8-16(12-22)10-17(9-15)13-22/h2-5,15-17,21H,6-14H2,1H3 |
| InChIKey | CKPBREZUIFELOF-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |