C21H27NO2S — CID 7072882
(2S)-3-(1-adamantylmethyl)-2-(4-methoxyphenyl)-1,3-thiazolidin-4-one (PubChem CID 7072882) has the molecular formula C21H27NO2S and a molecular weight of 357.52 g/mol. Its IUPAC name is (2S)-3-(1-adamantylmethyl)-2-(4-methoxyphenyl)-1,3-thiazolidin-4-one.
| Compound Name | (2S)-3-(1-adamantylmethyl)-2-(4-methoxyphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 7072882 |
| Molecular Formula | C21H27NO2S |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | (2S)-3-(1-adamantylmethyl)-2-(4-methoxyphenyl)-1,3-thiazolidin-4-one |
| SMILES | COc1ccc([C@@H]2SCC(=O)N2CC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C21H27NO2S/c1-24-18-4-2-17(3-5-18)20-22(19(23)12-25-20)13-21-9-14-6-15(10-21)8-16(7-14)11-21/h2-5,14-16,20H,6-13H2,1H3/t14?,15?,16?,20-,21?/m0/s1 |
| InChIKey | YYSJHNTZISOVJS-CQLMTFPYSA-N |
| XLogP | 4.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |