C26H32N6O3 — CID 122334965
2-[4-[4-[6-(azepan-1-yl)pyridazin-3-yl]piperazin-1-yl]-4-oxobutyl]isoindole-1,3-dione (PubChem CID 122334965) has the molecular formula C26H32N6O3 and a molecular weight of 476.58 g/mol. Its IUPAC name is 2-[4-[4-[6-(azepan-1-yl)pyridazin-3-yl]piperazin-1-yl]-4-oxobutyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[4-[6-(azepan-1-yl)pyridazin-3-yl]piperazin-1-yl]-4-oxobutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 122334965 |
| Molecular Formula | C26H32N6O3 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | 2-[4-[4-[6-(azepan-1-yl)pyridazin-3-yl]piperazin-1-yl]-4-oxobutyl]isoindole-1,3-dione |
| SMILES | O=C(CCCN1C(=O)c2ccccc2C1=O)N1CCN(c2ccc(N3CCCCCC3)nn2)CC1 |
| InChI | InChI=1S/C26H32N6O3/c33-24(10-7-15-32-25(34)20-8-3-4-9-21(20)26(32)35)31-18-16-30(17-19-31)23-12-11-22(27-28-23)29-13-5-1-2-6-14-29/h3-4,8-9,11-12H,1-2,5-7,10,13-19H2 |
| InChIKey | UTYFHMKBTSLACX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 89.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|