C25H31N7O3 — CID 122343491
2-[4-[4-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]piperazin-1-yl]-4-oxobutyl]isoindole-1,3-dione (PubChem CID 122343491) has the molecular formula C25H31N7O3 and a molecular weight of 477.57 g/mol. Its IUPAC name is 2-[4-[4-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]piperazin-1-yl]-4-oxobutyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[4-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]piperazin-1-yl]-4-oxobutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 122343491 |
| Molecular Formula | C25H31N7O3 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | 2-[4-[4-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]piperazin-1-yl]-4-oxobutyl]isoindole-1,3-dione |
| SMILES | CN1CCN(c2cc(N3CCN(C(=O)CCCN4C(=O)c5ccccc5C4=O)CC3)ncn2)CC1 |
| InChI | InChI=1S/C25H31N7O3/c1-28-9-11-29(12-10-28)21-17-22(27-18-26-21)30-13-15-31(16-14-30)23(33)7-4-8-32-24(34)19-5-2-3-6-20(19)25(32)35/h2-3,5-6,17-18H,4,7-16H2,1H3 |
| InChIKey | XLBWEVXSSLRSGX-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 93.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|