C23H22F2N6O — CID 122350027
(E)-3-(2,5-difluorophenyl)-1-[4-[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 122350027) has the molecular formula C23H22F2N6O and a molecular weight of 436.47 g/mol. Its IUPAC name is (E)-3-(2,5-difluorophenyl)-1-[4-[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2,5-difluorophenyl)-1-[4-[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 122350027 |
| Molecular Formula | C23H22F2N6O |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | (E)-3-(2,5-difluorophenyl)-1-[4-[2-methyl-6-(pyridin-2-ylamino)pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | Cc1nc(Nc2ccccn2)cc(N2CCN(C(=O)/C=C/c3cc(F)ccc3F)CC2)n1 |
| InChI | InChI=1S/C23H22F2N6O/c1-16-27-21(29-20-4-2-3-9-26-20)15-22(28-16)30-10-12-31(13-11-30)23(32)8-5-17-14-18(24)6-7-19(17)25/h2-9,14-15H,10-13H2,1H3,(H,26,27,28,29)/b8-5+ |
| InChIKey | KERHPDKTSSBGEL-VMPITWQZSA-N |
| XLogP | 3.56 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|