C21H19F2N5O — CID 122341680
(E)-3-(2,5-difluorophenyl)-1-[4-(6-pyrrol-1-ylpyridazin-3-yl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 122341680) has the molecular formula C21H19F2N5O and a molecular weight of 395.41 g/mol. Its IUPAC name is (E)-3-(2,5-difluorophenyl)-1-[4-(6-pyrrol-1-ylpyridazin-3-yl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2,5-difluorophenyl)-1-[4-(6-pyrrol-1-ylpyridazin-3-yl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 122341680 |
| Molecular Formula | C21H19F2N5O |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | (E)-3-(2,5-difluorophenyl)-1-[4-(6-pyrrol-1-ylpyridazin-3-yl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cc(F)ccc1F)N1CCN(c2ccc(-n3cccc3)nn2)CC1 |
| InChI | InChI=1S/C21H19F2N5O/c22-17-4-5-18(23)16(15-17)3-8-21(29)28-13-11-27(12-14-28)20-7-6-19(24-25-20)26-9-1-2-10-26/h1-10,15H,11-14H2/b8-3+ |
| InChIKey | VMJKELVMFSGEHD-FPYGCLRLSA-N |
| XLogP | 2.91 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|