C20H23F2N5O — CID 122351801
(E)-3-(2,5-difluorophenyl)-1-[4-[6-(ethylamino)-2-methylpyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 122351801) has the molecular formula C20H23F2N5O and a molecular weight of 387.43 g/mol. Its IUPAC name is (E)-3-(2,5-difluorophenyl)-1-[4-[6-(ethylamino)-2-methylpyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2,5-difluorophenyl)-1-[4-[6-(ethylamino)-2-methylpyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 122351801 |
| Molecular Formula | C20H23F2N5O |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | (E)-3-(2,5-difluorophenyl)-1-[4-[6-(ethylamino)-2-methylpyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | CCNc1cc(N2CCN(C(=O)/C=C/c3cc(F)ccc3F)CC2)nc(C)n1 |
| InChI | InChI=1S/C20H23F2N5O/c1-3-23-18-13-19(25-14(2)24-18)26-8-10-27(11-9-26)20(28)7-4-15-12-16(21)5-6-17(15)22/h4-7,12-13H,3,8-11H2,1-2H3,(H,23,24,25)/b7-4+ |
| InChIKey | CQZSYHKPWVWLKH-QPJJXVBHSA-N |
| XLogP | 2.86 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|