C22H21F2N5O — CID 122324349
(E)-3-(2,5-difluorophenyl)-N-[4-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]prop-2-enamide (PubChem CID 122324349) has the molecular formula C22H21F2N5O and a molecular weight of 409.44 g/mol. Its IUPAC name is (E)-3-(2,5-difluorophenyl)-N-[4-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2,5-difluorophenyl)-N-[4-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122324349 |
| Molecular Formula | C22H21F2N5O |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | (E)-3-(2,5-difluorophenyl)-N-[4-[[6-(ethylamino)-2-methylpyrimidin-4-yl]amino]phenyl]prop-2-enamide |
| SMILES | CCNc1cc(Nc2ccc(NC(=O)/C=C/c3cc(F)ccc3F)cc2)nc(C)n1 |
| InChI | InChI=1S/C22H21F2N5O/c1-3-25-20-13-21(27-14(2)26-20)28-17-6-8-18(9-7-17)29-22(30)11-4-15-12-16(23)5-10-19(15)24/h4-13H,3H2,1-2H3,(H,29,30)(H2,25,26,27,28)/b11-4+ |
| InChIKey | XTPRZHCDPOVZFQ-NYYWCZLTSA-N |
| XLogP | 4.89 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|