C28H27N5O — CID 122297804
(E)-N-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]-3-(2-methylphenyl)prop-2-enamide (PubChem CID 122297804) has the molecular formula C28H27N5O and a molecular weight of 449.56 g/mol. Its IUPAC name is (E)-N-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]-3-(2-methylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]-3-(2-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 122297804 |
| Molecular Formula | C28H27N5O |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | (E)-N-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]-3-(2-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(Nc2cc(Nc3ccc(NC(=O)/C=C/c4ccccc4C)cc3)nc(C)n2)cc1 |
| InChI | InChI=1S/C28H27N5O/c1-19-8-11-23(12-9-19)31-26-18-27(30-21(3)29-26)32-24-13-15-25(16-14-24)33-28(34)17-10-22-7-5-4-6-20(22)2/h4-18H,1-3H3,(H,33,34)(H2,29,30,31,32)/b17-10+ |
| InChIKey | RACAVMKJUVSLRC-LICLKQGHSA-N |
| XLogP | 6.54 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|