C29H39NO3Si — CID 122364545
(4S)-3-[(1E,3E)-1-[tert-butyl(diphenyl)silyl]oxy-2-methylhexa-1,3-dienyl]-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 122364545) has the molecular formula C29H39NO3Si and a molecular weight of 477.72 g/mol. Its IUPAC name is (4S)-3-[(1E,3E)-1-[tert-butyl(diphenyl)silyl]oxy-2-methylhexa-1,3-dienyl]-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(1E,3E)-1-[tert-butyl(diphenyl)silyl]oxy-2-methylhexa-1,3-dienyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 122364545 |
| Molecular Formula | C29H39NO3Si |
| Molecular Weight | 477.72 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | (4S)-3-[(1E,3E)-1-[tert-butyl(diphenyl)silyl]oxy-2-methylhexa-1,3-dienyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CC/C=C/C(C)=C(/O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N1C(=O)OC[C@@H]1C(C)C |
| InChI | InChI=1S/C29H39NO3Si/c1-8-9-16-23(4)27(30-26(22(2)3)21-32-28(30)31)33-34(29(5,6)7,24-17-12-10-13-18-24)25-19-14-11-15-20-25/h9-20,22,26H,8,21H2,1-7H3/b16-9+,27-23+/t26-/m1/s1 |
| InChIKey | JUKNBWLWNMQONU-QDFUZHFFSA-N |
| XLogP | 6.24 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.72 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|