About 1-(2-Methylpropyl)-1,4-diazepane
1-(2-Methylpropyl)-1,4-diazepane (PubChem CID 12236529) has the molecular formula C9H20N2
and a molecular weight of 156.27 g/mol. Its IUPAC name is 1-(2-methylpropyl)-1,4-diazepane.
Molecular Properties
| Compound Name | 1-(2-Methylpropyl)-1,4-diazepane |
| PubChem CID | 12236529 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | 1-(2-methylpropyl)-1,4-diazepane |
| SMILES | CC(C)CN1CCCNCC1 |
| InChI | InChI=1S/C9H20N2/c1-9(2)8-11-6-3-4-10-5-7-11/h9-10H,3-8H2,1-2H3 |
| InChIKey | JYVUQGFHFSVKFX-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 15.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | 102 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-Methylpropyl)-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-Methylpropyl)-1,4-diazepane?
The IUPAC name of 1-(2-Methylpropyl)-1,4-diazepane (CID 12236529) is 1-(2-methylpropyl)-1,4-diazepane.
What is the SMILES notation for 1-(2-Methylpropyl)-1,4-diazepane?
The canonical SMILES for 1-(2-Methylpropyl)-1,4-diazepane is CC(C)CN1CCCNCC1.
What is the InChIKey of 1-(2-Methylpropyl)-1,4-diazepane?
The InChIKey is JYVUQGFHFSVKFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2/c1-9(2)8-11-6-3-4-10-5-7-11/h9-10H,3-8H2,1-2H3.
What are the key properties of 1-(2-Methylpropyl)-1,4-diazepane?
1-(2-Methylpropyl)-1,4-diazepane has a molecular weight of 156.27 g/mol, XLogP of 0.90, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-Methylpropyl)-1,4-diazepane is sourced from PubChem (CID 12236529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).