About 3-[(1S)-1-cyclopenta-2,4-dien-1-yl-3-oxobutyl]-4-hydroxychromen-2-one
3-[(1S)-1-cyclopenta-2,4-dien-1-yl-3-oxobutyl]-4-hydroxychromen-2-one (PubChem CID 122365693) has the molecular formula C18H16O4
and a molecular weight of 296.32 g/mol. Its IUPAC name is 3-[(1S)-1-cyclopenta-2,4-dien-1-yl-3-oxobutyl]-4-hydroxychromen-2-one.
Molecular Properties
| Compound Name | 3-[(1S)-1-cyclopenta-2,4-dien-1-yl-3-oxobutyl]-4-hydroxychromen-2-one |
| PubChem CID | 122365693 |
| Molecular Formula | C18H16O4 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 3-[(1S)-1-cyclopenta-2,4-dien-1-yl-3-oxobutyl]-4-hydroxychromen-2-one |
| SMILES | CC(=O)C[C@H](c1c(O)c2ccccc2oc1=O)C1C=CC=C1 |
| InChI | InChI=1S/C18H16O4/c1-11(19)10-14(12-6-2-3-7-12)16-17(20)13-8-4-5-9-15(13)22-18(16)21/h2-9,12,14,20H,10H2,1H3/t14-/m0/s1 |
| InChIKey | DPWRXDLUJRIJNF-AWEZNQCLSA-N |
| XLogP | 3.30 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1S)-1-cyclopenta-2,4-dien-1-yl-3-oxobutyl]-4-hydroxychromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1S)-1-cyclopenta-2,4-dien-1-yl-3-oxobutyl]-4-hydroxychromen-2-one?
The IUPAC name of 3-[(1S)-1-cyclopenta-2,4-dien-1-yl-3-oxobutyl]-4-hydroxychromen-2-one (CID 122365693) is 3-[(1S)-1-cyclopenta-2,4-dien-1-yl-3-oxobutyl]-4-hydroxychromen-2-one.
What is the SMILES notation for 3-[(1S)-1-cyclopenta-2,4-dien-1-yl-3-oxobutyl]-4-hydroxychromen-2-one?
The canonical SMILES for 3-[(1S)-1-cyclopenta-2,4-dien-1-yl-3-oxobutyl]-4-hydroxychromen-2-one is CC(=O)C[C@H](c1c(O)c2ccccc2oc1=O)C1C=CC=C1.
What is the InChIKey of 3-[(1S)-1-cyclopenta-2,4-dien-1-yl-3-oxobutyl]-4-hydroxychromen-2-one?
The InChIKey is DPWRXDLUJRIJNF-AWEZNQCLSA-N. The full InChI is InChI=1S/C18H16O4/c1-11(19)10-14(12-6-2-3-7-12)16-17(20)13-8-4-5-9-15(13)22-18(16)21/h2-9,12,14,20H,10H2,1H3/t14-/m0/s1.
What are the key properties of 3-[(1S)-1-cyclopenta-2,4-dien-1-yl-3-oxobutyl]-4-hydroxychromen-2-one?
3-[(1S)-1-cyclopenta-2,4-dien-1-yl-3-oxobutyl]-4-hydroxychromen-2-one has a molecular weight of 296.32 g/mol, XLogP of 3.30, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1S)-1-cyclopenta-2,4-dien-1-yl-3-oxobutyl]-4-hydroxychromen-2-one is sourced from PubChem (CID 122365693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).