C19H18BrF2NO4 — CID 122366304
[2-[(2-bromo-2,2-difluoroethyl)-[(4-methoxyphenyl)methyl]carbamoyl]phenyl] acetate (PubChem CID 122366304) has the molecular formula C19H18BrF2NO4 and a molecular weight of 442.26 g/mol. Its IUPAC name is [2-[(2-bromo-2,2-difluoroethyl)-[(4-methoxyphenyl)methyl]carbamoyl]phenyl] acetate.
| Compound Name | [2-[(2-bromo-2,2-difluoroethyl)-[(4-methoxyphenyl)methyl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 122366304 |
| Molecular Formula | C19H18BrF2NO4 |
| Molecular Weight | 442.26 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | [2-[(2-bromo-2,2-difluoroethyl)-[(4-methoxyphenyl)methyl]carbamoyl]phenyl] acetate |
| SMILES | COc1ccc(CN(CC(F)(F)Br)C(=O)c2ccccc2OC(C)=O)cc1 |
| InChI | InChI=1S/C19H18BrF2NO4/c1-13(24)27-17-6-4-3-5-16(17)18(25)23(12-19(20,21)22)11-14-7-9-15(26-2)10-8-14/h3-10H,11-12H2,1-2H3 |
| InChIKey | YBNIRUWIODQQSX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.26 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|