C19H22O3 — CID 122366848
(3aR,8bR)-2,6,6-trimethyl-1-(5-methylfuran-2-yl)-3a,5,7,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-8-one (PubChem CID 122366848) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is (3aR,8bR)-2,6,6-trimethyl-1-(5-methylfuran-2-yl)-3a,5,7,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-8-one.
| Compound Name | (3aR,8bR)-2,6,6-trimethyl-1-(5-methylfuran-2-yl)-3a,5,7,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-8-one |
|---|---|
| PubChem CID | 122366848 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (3aR,8bR)-2,6,6-trimethyl-1-(5-methylfuran-2-yl)-3a,5,7,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-8-one |
| SMILES | CC1=C[C@H]2OC3=C(C(=O)CC(C)(C)C3)[C@H]2C1c1ccc(C)o1 |
| InChI | InChI=1S/C19H22O3/c1-10-7-14-18(16(10)13-6-5-11(2)21-13)17-12(20)8-19(3,4)9-15(17)22-14/h5-7,14,16,18H,8-9H2,1-4H3/t14-,16?,18-/m1/s1 |
| InChIKey | DYROTPWLWFUWQV-OXPKRCOGSA-N |
| XLogP | 4.29 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|