C12H11FN2O3 — CID 122367157
5-(4-fluorophenyl)-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 122367157) has the molecular formula C12H11FN2O3 and a molecular weight of 250.23 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(4-fluorophenyl)-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 122367157 |
| Molecular Formula | C12H11FN2O3 |
| Molecular Weight | 250.23 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 5-(4-fluorophenyl)-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)C(c2ccc(F)cc2)C(=O)N(C)C1=O |
| InChI | InChI=1S/C12H11FN2O3/c1-14-10(16)9(11(17)15(2)12(14)18)7-3-5-8(13)6-4-7/h3-6,9H,1-2H3 |
| InChIKey | MSACOOIMQHJVMK-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.23 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|