C18H24INO3S — CID 122368808
ethyl (2S)-1-tert-butylsulfinyl-2-[(2-iodophenyl)methyl]-2,5-dihydropyrrole-3-carboxylate (PubChem CID 122368808) has the molecular formula C18H24INO3S and a molecular weight of 461.37 g/mol. Its IUPAC name is ethyl (2S)-1-tert-butylsulfinyl-2-[(2-iodophenyl)methyl]-2,5-dihydropyrrole-3-carboxylate.
| Compound Name | ethyl (2S)-1-tert-butylsulfinyl-2-[(2-iodophenyl)methyl]-2,5-dihydropyrrole-3-carboxylate |
|---|---|
| PubChem CID | 122368808 |
| Molecular Formula | C18H24INO3S |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | ethyl (2S)-1-tert-butylsulfinyl-2-[(2-iodophenyl)methyl]-2,5-dihydropyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=CCN(S(=O)C(C)(C)C)[C@H]1Cc1ccccc1I |
| InChI | InChI=1S/C18H24INO3S/c1-5-23-17(21)14-10-11-20(24(22)18(2,3)4)16(14)12-13-8-6-7-9-15(13)19/h6-10,16H,5,11-12H2,1-4H3/t16-,24?/m0/s1 |
| InChIKey | IEJWFPCJVVQZLF-FXIRQEPWSA-N |
| XLogP | 3.47 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|