C22H26O3Si — CID 122374661
1-benzofuran-2-yl-dimethyl-[2-(oxan-2-yloxymethyl)phenyl]silane (PubChem CID 122374661) has the molecular formula C22H26O3Si and a molecular weight of 366.53 g/mol. Its IUPAC name is 1-benzofuran-2-yl-dimethyl-[2-(oxan-2-yloxymethyl)phenyl]silane.
| Compound Name | 1-benzofuran-2-yl-dimethyl-[2-(oxan-2-yloxymethyl)phenyl]silane |
|---|---|
| PubChem CID | 122374661 |
| Molecular Formula | C22H26O3Si |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 1-benzofuran-2-yl-dimethyl-[2-(oxan-2-yloxymethyl)phenyl]silane |
| SMILES | C[Si](C)(c1cc2ccccc2o1)c1ccccc1COC1CCCCO1 |
| InChI | InChI=1S/C22H26O3Si/c1-26(2,22-15-17-9-3-5-11-19(17)25-22)20-12-6-4-10-18(20)16-24-21-13-7-8-14-23-21/h3-6,9-12,15,21H,7-8,13-14,16H2,1-2H3 |
| InChIKey | GYXCHQXKECZEHD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|