C36H49BrO2Si2 — CID 23643149
(3-bromo-5,5-dipentylbenzo[b][1]benzosilol-7-yl)-dimethyl-[2-(oxan-2-yloxymethyl)phenyl]silane (PubChem CID 23643149) has the molecular formula C36H49BrO2Si2 and a molecular weight of 649.86 g/mol. Its IUPAC name is (3-bromo-5,5-dipentylbenzo[b][1]benzosilol-7-yl)-dimethyl-[2-(oxan-2-yloxymethyl)phenyl]silane.
| Compound Name | (3-bromo-5,5-dipentylbenzo[b][1]benzosilol-7-yl)-dimethyl-[2-(oxan-2-yloxymethyl)phenyl]silane |
|---|---|
| PubChem CID | 23643149 |
| Molecular Formula | C36H49BrO2Si2 |
| Molecular Weight | 649.86 g/mol |
| Exact Mass | 648.25 |
| IUPAC Name | (3-bromo-5,5-dipentylbenzo[b][1]benzosilol-7-yl)-dimethyl-[2-(oxan-2-yloxymethyl)phenyl]silane |
| SMILES | CCCCC[Si]1(CCCCC)c2cc(Br)ccc2-c2ccc([Si](C)(C)c3ccccc3COC3CCCCO3)cc21 |
| InChI | InChI=1S/C36H49BrO2Si2/c1-5-7-13-23-41(24-14-8-6-2)34-25-29(37)18-20-31(34)32-21-19-30(26-35(32)41)40(3,4)33-16-10-9-15-28(33)27-39-36-17-11-12-22-38-36/h9-10,15-16,18-21,25-26,36H,5-8,11-14,17,22-24,27H2,1-4H3 |
| InChIKey | HUSPKQJRBLPUQG-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.86 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|