C18H19NO4 — CID 15338659
2-[3-(oxan-2-yloxymethyl)quinolin-2-yl]prop-2-enoic acid (PubChem CID 15338659) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is 2-[3-(oxan-2-yloxymethyl)quinolin-2-yl]prop-2-enoic acid.
| Compound Name | 2-[3-(oxan-2-yloxymethyl)quinolin-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 15338659 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 2-[3-(oxan-2-yloxymethyl)quinolin-2-yl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)c1nc2ccccc2cc1COC1CCCCO1 |
| InChI | InChI=1S/C18H19NO4/c1-12(18(20)21)17-14(11-23-16-8-4-5-9-22-16)10-13-6-2-3-7-15(13)19-17/h2-3,6-7,10,16H,1,4-5,8-9,11H2,(H,20,21) |
| InChIKey | RQMINLKWZFUWMC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|