C20H12F3NO — CID 122375970
(3E)-2-quinolin-8-yl-3-(2,2,2-trifluoroethylidene)inden-1-one (PubChem CID 122375970) has the molecular formula C20H12F3NO and a molecular weight of 339.32 g/mol. Its IUPAC name is (3E)-2-quinolin-8-yl-3-(2,2,2-trifluoroethylidene)inden-1-one.
| Compound Name | (3E)-2-quinolin-8-yl-3-(2,2,2-trifluoroethylidene)inden-1-one |
|---|---|
| PubChem CID | 122375970 |
| Molecular Formula | C20H12F3NO |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | (3E)-2-quinolin-8-yl-3-(2,2,2-trifluoroethylidene)inden-1-one |
| SMILES | O=C1c2ccccc2/C(=C/C(F)(F)F)C1c1cccc2cccnc12 |
| InChI | InChI=1S/C20H12F3NO/c21-20(22,23)11-16-13-7-1-2-8-14(13)19(25)17(16)15-9-3-5-12-6-4-10-24-18(12)15/h1-11,17H/b16-11- |
| InChIKey | BYNNWDBQJCFICD-WJDWOHSUSA-N |
| XLogP | 5.16 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |