C10H8ClNO2S2 — CID 122376714
(2R)-4'-chloro-1-oxospiro[1,3-dithiolane-2,3'-1H-indole]-2'-one (PubChem CID 122376714) has the molecular formula C10H8ClNO2S2 and a molecular weight of 273.77 g/mol. Its IUPAC name is (2R)-4'-chloro-1-oxospiro[1,3-dithiolane-2,3'-1H-indole]-2'-one.
| Compound Name | (2R)-4'-chloro-1-oxospiro[1,3-dithiolane-2,3'-1H-indole]-2'-one |
|---|---|
| PubChem CID | 122376714 |
| Molecular Formula | C10H8ClNO2S2 |
| Molecular Weight | 273.77 g/mol |
| Exact Mass | 272.97 |
| IUPAC Name | (2R)-4'-chloro-1-oxospiro[1,3-dithiolane-2,3'-1H-indole]-2'-one |
| SMILES | O=C1Nc2cccc(Cl)c2[C@]12SCCS2=O |
| InChI | InChI=1S/C10H8ClNO2S2/c11-6-2-1-3-7-8(6)10(9(13)12-7)15-4-5-16(10)14/h1-3H,4-5H2,(H,12,13)/t10-,16?/m1/s1 |
| InChIKey | DEPSNNOIRDMCAE-HQNRFAHOSA-N |
| XLogP | 1.94 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.77 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |