C11H9BN2O3 — CID 122379383
2-[(1-hydroxy-3H-2,1-benzoxaborol-4-yl)oxy]pyrazine (PubChem CID 122379383) has the molecular formula C11H9BN2O3 and a molecular weight of 228.02 g/mol. Its IUPAC name is 2-[(1-hydroxy-3H-2,1-benzoxaborol-4-yl)oxy]pyrazine.
| Compound Name | 2-[(1-hydroxy-3H-2,1-benzoxaborol-4-yl)oxy]pyrazine |
|---|---|
| PubChem CID | 122379383 |
| Molecular Formula | C11H9BN2O3 |
| Molecular Weight | 228.02 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 2-[(1-hydroxy-3H-2,1-benzoxaborol-4-yl)oxy]pyrazine |
| SMILES | OB1OCc2c(Oc3cnccn3)cccc21 |
| InChI | InChI=1S/C11H9BN2O3/c15-12-9-2-1-3-10(8(9)7-16-12)17-11-6-13-4-5-14-11/h1-6,15H,7H2 |
| InChIKey | SKSFNXWFYVHFQE-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.02 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|