C12H12BN3O3 — CID 122178902
[5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazin-2-yl]methanamine (PubChem CID 122178902) has the molecular formula C12H12BN3O3 and a molecular weight of 257.06 g/mol. Its IUPAC name is [5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazin-2-yl]methanamine.
| Compound Name | [5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazin-2-yl]methanamine |
|---|---|
| PubChem CID | 122178902 |
| Molecular Formula | C12H12BN3O3 |
| Molecular Weight | 257.06 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | [5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazin-2-yl]methanamine |
| SMILES | NCc1cnc(Oc2ccc3c(c2)B(O)OC3)cn1 |
| InChI | InChI=1S/C12H12BN3O3/c14-4-9-5-16-12(6-15-9)19-10-2-1-8-7-18-13(17)11(8)3-10/h1-3,5-6,17H,4,7,14H2 |
| InChIKey | NEWUSHAOJJAUPA-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.06 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|