About [5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazin-2-yl]methanamine
[5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazin-2-yl]methanamine (PubChem CID 122178902) has the molecular formula C12H12BN3O3
and a molecular weight of 257.06 g/mol. Its IUPAC name is [5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazin-2-yl]methanamine.
Molecular Properties
| Compound Name | [5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazin-2-yl]methanamine |
| PubChem CID | 122178902 |
| Molecular Formula | C12H12BN3O3 |
| Molecular Weight | 257.06 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | [5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazin-2-yl]methanamine |
| SMILES | NCc1cnc(Oc2ccc3c(c2)B(O)OC3)cn1 |
| InChI | InChI=1S/C12H12BN3O3/c14-4-9-5-16-12(6-15-9)19-10-2-1-8-7-18-13(17)11(8)3-10/h1-3,5-6,17H,4,7,14H2 |
| InChIKey | NEWUSHAOJJAUPA-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.06 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazin-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazin-2-yl]methanamine?
The IUPAC name of [5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazin-2-yl]methanamine (CID 122178902) is [5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazin-2-yl]methanamine.
What is the SMILES notation for [5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazin-2-yl]methanamine?
The canonical SMILES for [5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazin-2-yl]methanamine is NCc1cnc(Oc2ccc3c(c2)B(O)OC3)cn1.
What is the InChIKey of [5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazin-2-yl]methanamine?
The InChIKey is NEWUSHAOJJAUPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BN3O3/c14-4-9-5-16-12(6-15-9)19-10-2-1-8-7-18-13(17)11(8)3-10/h1-3,5-6,17H,4,7,14H2.
What are the key properties of [5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazin-2-yl]methanamine?
[5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazin-2-yl]methanamine has a molecular weight of 257.06 g/mol, XLogP of -0.05, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazin-2-yl]methanamine is sourced from PubChem (CID 122178902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).