C14H17N3 — CID 122379886
3-benzyl-5,6,7,8-tetrahydro-4H-cyclohepta[d]triazole (PubChem CID 122379886) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is 3-benzyl-5,6,7,8-tetrahydro-4H-cyclohepta[d]triazole.
| Compound Name | 3-benzyl-5,6,7,8-tetrahydro-4H-cyclohepta[d]triazole |
|---|---|
| PubChem CID | 122379886 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 3-benzyl-5,6,7,8-tetrahydro-4H-cyclohepta[d]triazole |
| SMILES | c1ccc(Cn2nnc3c2CCCCC3)cc1 |
| InChI | InChI=1S/C14H17N3/c1-3-7-12(8-4-1)11-17-14-10-6-2-5-9-13(14)15-16-17/h1,3-4,7-8H,2,5-6,9-11H2 |
| InChIKey | IBTLMFBJMWIUGQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |