C13H14N6 — CID 138975522
1-[(4-azidophenyl)methyl]-4,5,6,7-tetrahydrobenzotriazole (PubChem CID 138975522) has the molecular formula C13H14N6 and a molecular weight of 254.30 g/mol. Its IUPAC name is 1-[(4-azidophenyl)methyl]-4,5,6,7-tetrahydrobenzotriazole.
| Compound Name | 1-[(4-azidophenyl)methyl]-4,5,6,7-tetrahydrobenzotriazole |
|---|---|
| PubChem CID | 138975522 |
| Molecular Formula | C13H14N6 |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 1-[(4-azidophenyl)methyl]-4,5,6,7-tetrahydrobenzotriazole |
| SMILES | [N-]=[N+]=Nc1ccc(Cn2nnc3c2CCCC3)cc1 |
| InChI | InChI=1S/C13H14N6/c14-17-15-11-7-5-10(6-8-11)9-19-13-4-2-1-3-12(13)16-18-19/h5-8H,1-4,9H2 |
| InChIKey | LRSOYWYXAIMXNF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 79.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|