C23H29N3O4 — CID 122381415
ditert-butyl 5-[(5-amino-2-methylphenyl)diazenyl]benzene-1,3-dicarboxylate (PubChem CID 122381415) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is ditert-butyl 5-[(5-amino-2-methylphenyl)diazenyl]benzene-1,3-dicarboxylate.
| Compound Name | ditert-butyl 5-[(5-amino-2-methylphenyl)diazenyl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 122381415 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | ditert-butyl 5-[(5-amino-2-methylphenyl)diazenyl]benzene-1,3-dicarboxylate |
| SMILES | Cc1ccc(N)cc1/N=N/c1cc(C(=O)OC(C)(C)C)cc(C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C23H29N3O4/c1-14-8-9-17(24)13-19(14)26-25-18-11-15(20(27)29-22(2,3)4)10-16(12-18)21(28)30-23(5,6)7/h8-13H,24H2,1-7H3/b26-25+ |
| InChIKey | QRDJKKGNZIDRON-OCEACIFDSA-N |
| XLogP | 5.90 |
| TPSA | 103.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|