About tert-butyl 4-fluorosulfanyloxybenzoate;3-chloro-4-methylaniline;ethane
tert-butyl 4-fluorosulfanyloxybenzoate;3-chloro-4-methylaniline;ethane (PubChem CID 156874693) has the molecular formula C20H27ClFNO3S
and a molecular weight of 415.96 g/mol. Its IUPAC name is tert-butyl 4-fluorosulfanyloxybenzoate;3-chloro-4-methylaniline;ethane.
Molecular Properties
| Compound Name | tert-butyl 4-fluorosulfanyloxybenzoate;3-chloro-4-methylaniline;ethane |
| PubChem CID | 156874693 |
| Molecular Formula | C20H27ClFNO3S |
| Molecular Weight | 415.96 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | tert-butyl 4-fluorosulfanyloxybenzoate;3-chloro-4-methylaniline;ethane |
| SMILES | CC.CC(C)(C)OC(=O)c1ccc(OSF)cc1.Cc1ccc(N)cc1Cl |
| InChI | InChI=1S/C11H13FO3S.C7H8ClN.C2H6/c1-11(2,3)14-10(13)8-4-6-9(7-5-8)15-16-12;1-5-2-3-6(9)4-7(5)8;1-2/h4-7H,1-3H3;2-4H,9H2,1H3;1-2H3 |
| InChIKey | DHKHUHBXBADRAY-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.96 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-fluorosulfanyloxybenzoate;3-chloro-4-methylaniline;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-fluorosulfanyloxybenzoate;3-chloro-4-methylaniline;ethane?
The IUPAC name of tert-butyl 4-fluorosulfanyloxybenzoate;3-chloro-4-methylaniline;ethane (CID 156874693) is tert-butyl 4-fluorosulfanyloxybenzoate;3-chloro-4-methylaniline;ethane.
What is the SMILES notation for tert-butyl 4-fluorosulfanyloxybenzoate;3-chloro-4-methylaniline;ethane?
The canonical SMILES for tert-butyl 4-fluorosulfanyloxybenzoate;3-chloro-4-methylaniline;ethane is CC.CC(C)(C)OC(=O)c1ccc(OSF)cc1.Cc1ccc(N)cc1Cl.
What is the InChIKey of tert-butyl 4-fluorosulfanyloxybenzoate;3-chloro-4-methylaniline;ethane?
The InChIKey is DHKHUHBXBADRAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FO3S.C7H8ClN.C2H6/c1-11(2,3)14-10(13)8-4-6-9(7-5-8)15-16-12;1-5-2-3-6(9)4-7(5)8;1-2/h4-7H,1-3H3;2-4H,9H2,1H3;1-2H3.
What are the key properties of tert-butyl 4-fluorosulfanyloxybenzoate;3-chloro-4-methylaniline;ethane?
tert-butyl 4-fluorosulfanyloxybenzoate;3-chloro-4-methylaniline;ethane has a molecular weight of 415.96 g/mol, XLogP of 6.81, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-fluorosulfanyloxybenzoate;3-chloro-4-methylaniline;ethane is sourced from PubChem (CID 156874693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).