C30H36O3Si — CID 122384656
4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3,5-dimethyl-2-propanoylbenzaldehyde (PubChem CID 122384656) has the molecular formula C30H36O3Si and a molecular weight of 472.70 g/mol. Its IUPAC name is 4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3,5-dimethyl-2-propanoylbenzaldehyde.
| Compound Name | 4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3,5-dimethyl-2-propanoylbenzaldehyde |
|---|---|
| PubChem CID | 122384656 |
| Molecular Formula | C30H36O3Si |
| Molecular Weight | 472.70 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3,5-dimethyl-2-propanoylbenzaldehyde |
| SMILES | CCC(=O)c1c(C=O)cc(C)c(CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c1C |
| InChI | InChI=1S/C30H36O3Si/c1-7-28(32)29-23(3)27(22(2)20-24(29)21-31)18-19-33-34(30(4,5)6,25-14-10-8-11-15-25)26-16-12-9-13-17-26/h8-17,20-21H,7,18-19H2,1-6H3 |
| InChIKey | OGVMOTDFTKDBKM-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.70 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|