C21H36O2Si2 — CID 100968424
6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-8-trimethylsilyl-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 100968424) has the molecular formula C21H36O2Si2 and a molecular weight of 376.69 g/mol. Its IUPAC name is 6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-8-trimethylsilyl-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-8-trimethylsilyl-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 100968424 |
| Molecular Formula | C21H36O2Si2 |
| Molecular Weight | 376.69 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-8-trimethylsilyl-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCc1cc2c(c([Si](C)(C)C)c1)C(=O)CCC2 |
| InChI | InChI=1S/C21H36O2Si2/c1-21(2,3)25(7,8)23-13-12-16-14-17-10-9-11-18(22)20(17)19(15-16)24(4,5)6/h14-15H,9-13H2,1-8H3 |
| InChIKey | RSKPXNUIDQABJQ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.69 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|