C21H31F3O2Si — CID 58968636
[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(trifluoromethyl)phenyl]-cyclohexylmethanone (PubChem CID 58968636) has the molecular formula C21H31F3O2Si and a molecular weight of 400.56 g/mol. Its IUPAC name is [2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(trifluoromethyl)phenyl]-cyclohexylmethanone.
| Compound Name | [2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(trifluoromethyl)phenyl]-cyclohexylmethanone |
|---|---|
| PubChem CID | 58968636 |
| Molecular Formula | C21H31F3O2Si |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | [2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(trifluoromethyl)phenyl]-cyclohexylmethanone |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cc(C(F)(F)F)ccc1C(=O)C1CCCCC1 |
| InChI | InChI=1S/C21H31F3O2Si/c1-20(2,3)27(4,5)26-14-16-13-17(21(22,23)24)11-12-18(16)19(25)15-9-7-6-8-10-15/h11-13,15H,6-10,14H2,1-5H3 |
| InChIKey | VEFFWUPMJOFTBT-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|