C43H45NO6 — CID 122386137
N-benzyl-N-[(3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide (PubChem CID 122386137) has the molecular formula C43H45NO6 and a molecular weight of 671.83 g/mol. Its IUPAC name is N-benzyl-N-[(3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-benzyl-N-[(3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 122386137 |
| Molecular Formula | C43H45NO6 |
| Molecular Weight | 671.83 g/mol |
| Exact Mass | 671.32 |
| IUPAC Name | N-benzyl-N-[(3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide |
| SMILES | CC(=O)N(Cc1ccccc1)[C@H]1C(OCc2ccccc2)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C43H45NO6/c1-33(45)44(27-34-17-7-2-8-18-34)40-42(48-30-37-23-13-5-14-24-37)41(47-29-36-21-11-4-12-22-36)39(32-46-28-35-19-9-3-10-20-35)50-43(40)49-31-38-25-15-6-16-26-38/h2-26,39-43H,27-32H2,1H3/t39-,40-,41-,42-,43?/m1/s1 |
| InChIKey | WTJIQKKZOUBECD-DEMYYSEOSA-N |
| XLogP | 7.73 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.83 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |