C10H14N+ — CID 122386244
(4aR)-1-methyl-2,3,4,4a-tetrahydroquinolin-1-ium (PubChem CID 122386244) has the molecular formula C10H14N+ and a molecular weight of 148.23 g/mol. Its IUPAC name is (4aR)-1-methyl-2,3,4,4a-tetrahydroquinolin-1-ium.
| Compound Name | (4aR)-1-methyl-2,3,4,4a-tetrahydroquinolin-1-ium |
|---|---|
| PubChem CID | 122386244 |
| Molecular Formula | C10H14N+ |
| Molecular Weight | 148.23 g/mol |
| Exact Mass | 148.11 |
| IUPAC Name | (4aR)-1-methyl-2,3,4,4a-tetrahydroquinolin-1-ium |
| SMILES | C[N+]1=C2C=CC=C[C@H]2CCC1 |
| InChI | InChI=1S/C10H14N/c1-11-8-4-6-9-5-2-3-7-10(9)11/h2-3,5,7,9H,4,6,8H2,1H3/q+1/t9-/m0/s1 |
| InChIKey | ZTPQSXCKKIDVSR-VIFPVBQESA-N |
| XLogP | 1.61 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.23 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|