C15H27N3O3S — CID 122387466
4-amino-N-[(2R)-1-[[(2S)-1-hydroxy-3-methylbutan-2-yl]-methylamino]propan-2-yl]benzenesulfonamide (PubChem CID 122387466) has the molecular formula C15H27N3O3S and a molecular weight of 329.47 g/mol. Its IUPAC name is 4-amino-N-[(2R)-1-[[(2S)-1-hydroxy-3-methylbutan-2-yl]-methylamino]propan-2-yl]benzenesulfonamide.
| Compound Name | 4-amino-N-[(2R)-1-[[(2S)-1-hydroxy-3-methylbutan-2-yl]-methylamino]propan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 122387466 |
| Molecular Formula | C15H27N3O3S |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | 4-amino-N-[(2R)-1-[[(2S)-1-hydroxy-3-methylbutan-2-yl]-methylamino]propan-2-yl]benzenesulfonamide |
| SMILES | CC(C)[C@@H](CO)N(C)C[C@@H](C)NS(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C15H27N3O3S/c1-11(2)15(10-19)18(4)9-12(3)17-22(20,21)14-7-5-13(16)6-8-14/h5-8,11-12,15,17,19H,9-10,16H2,1-4H3/t12-,15-/m1/s1 |
| InChIKey | OMQREANCCSAOAU-IUODEOHRSA-N |
| XLogP | 0.88 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|