C10H16N2O3S — CID 65036872
4-amino-N-(3-hydroxy-2-methylpropyl)benzenesulfonamide (PubChem CID 65036872) has the molecular formula C10H16N2O3S and a molecular weight of 244.32 g/mol. Its IUPAC name is 4-amino-N-(3-hydroxy-2-methylpropyl)benzenesulfonamide.
| Compound Name | 4-amino-N-(3-hydroxy-2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 65036872 |
| Molecular Formula | C10H16N2O3S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 4-amino-N-(3-hydroxy-2-methylpropyl)benzenesulfonamide |
| SMILES | CC(CO)CNS(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C10H16N2O3S/c1-8(7-13)6-12-16(14,15)10-4-2-9(11)3-5-10/h2-5,8,12-13H,6-7,11H2,1H3 |
| InChIKey | QKIHAYOTJHUZNP-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|