C10H16N2O9S3 — CID 174742087
1-hydroxyethoxysulfonyl 2-[(4-aminophenyl)sulfonylamino]ethanesulfonate (PubChem CID 174742087) has the molecular formula C10H16N2O9S3 and a molecular weight of 404.44 g/mol. Its IUPAC name is 1-hydroxyethoxysulfonyl 2-[(4-aminophenyl)sulfonylamino]ethanesulfonate.
| Compound Name | 1-hydroxyethoxysulfonyl 2-[(4-aminophenyl)sulfonylamino]ethanesulfonate |
|---|---|
| PubChem CID | 174742087 |
| Molecular Formula | C10H16N2O9S3 |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.00 |
| IUPAC Name | 1-hydroxyethoxysulfonyl 2-[(4-aminophenyl)sulfonylamino]ethanesulfonate |
| SMILES | CC(O)OS(=O)(=O)OS(=O)(=O)CCNS(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C10H16N2O9S3/c1-8(13)20-24(18,19)21-22(14,15)7-6-12-23(16,17)10-4-2-9(11)3-5-10/h2-5,8,12-13H,6-7,11H2,1H3 |
| InChIKey | KBEHLMAYJYTRKS-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 179.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|