About methyl 3-(bromomethyl)-5-methyl-4H-1,2-oxazole-5-carboxylate
methyl 3-(bromomethyl)-5-methyl-4H-1,2-oxazole-5-carboxylate (PubChem CID 122388954) has the molecular formula C7H10BrNO3
and a molecular weight of 236.06 g/mol. Its IUPAC name is methyl 3-(bromomethyl)-5-methyl-4H-1,2-oxazole-5-carboxylate.
Molecular Properties
| Compound Name | methyl 3-(bromomethyl)-5-methyl-4H-1,2-oxazole-5-carboxylate |
| PubChem CID | 122388954 |
| Molecular Formula | C7H10BrNO3 |
| Molecular Weight | 236.06 g/mol |
| Exact Mass | 234.98 |
| IUPAC Name | methyl 3-(bromomethyl)-5-methyl-4H-1,2-oxazole-5-carboxylate |
| SMILES | COC(=O)C1(C)CC(CBr)=NO1 |
| InChI | InChI=1S/C7H10BrNO3/c1-7(6(10)11-2)3-5(4-8)9-12-7/h3-4H2,1-2H3 |
| InChIKey | XBRWGKLUXPTMHV-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.06 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(bromomethyl)-5-methyl-4H-1,2-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(bromomethyl)-5-methyl-4H-1,2-oxazole-5-carboxylate?
The IUPAC name of methyl 3-(bromomethyl)-5-methyl-4H-1,2-oxazole-5-carboxylate (CID 122388954) is methyl 3-(bromomethyl)-5-methyl-4H-1,2-oxazole-5-carboxylate.
What is the SMILES notation for methyl 3-(bromomethyl)-5-methyl-4H-1,2-oxazole-5-carboxylate?
The canonical SMILES for methyl 3-(bromomethyl)-5-methyl-4H-1,2-oxazole-5-carboxylate is COC(=O)C1(C)CC(CBr)=NO1.
What is the InChIKey of methyl 3-(bromomethyl)-5-methyl-4H-1,2-oxazole-5-carboxylate?
The InChIKey is XBRWGKLUXPTMHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10BrNO3/c1-7(6(10)11-2)3-5(4-8)9-12-7/h3-4H2,1-2H3.
What are the key properties of methyl 3-(bromomethyl)-5-methyl-4H-1,2-oxazole-5-carboxylate?
methyl 3-(bromomethyl)-5-methyl-4H-1,2-oxazole-5-carboxylate has a molecular weight of 236.06 g/mol, XLogP of 1.09, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(bromomethyl)-5-methyl-4H-1,2-oxazole-5-carboxylate is sourced from PubChem (CID 122388954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).