C7H10BrNO3 — CID 122388954
methyl 3-(bromomethyl)-5-methyl-4H-1,2-oxazole-5-carboxylate (PubChem CID 122388954) has the molecular formula C7H10BrNO3 and a molecular weight of 236.06 g/mol. Its IUPAC name is methyl 3-(bromomethyl)-5-methyl-4H-1,2-oxazole-5-carboxylate.
| Compound Name | methyl 3-(bromomethyl)-5-methyl-4H-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 122388954 |
| Molecular Formula | C7H10BrNO3 |
| Molecular Weight | 236.06 g/mol |
| Exact Mass | 234.98 |
| IUPAC Name | methyl 3-(bromomethyl)-5-methyl-4H-1,2-oxazole-5-carboxylate |
| SMILES | COC(=O)C1(C)CC(CBr)=NO1 |
| InChI | InChI=1S/C7H10BrNO3/c1-7(6(10)11-2)3-5(4-8)9-12-7/h3-4H2,1-2H3 |
| InChIKey | XBRWGKLUXPTMHV-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.06 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|