C22H24N2O2 — CID 122391556
1-benzyl-N-tert-butyl-5-oxo-3-phenyl-2H-pyrrole-2-carboxamide (PubChem CID 122391556) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 1-benzyl-N-tert-butyl-5-oxo-3-phenyl-2H-pyrrole-2-carboxamide.
| Compound Name | 1-benzyl-N-tert-butyl-5-oxo-3-phenyl-2H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 122391556 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 1-benzyl-N-tert-butyl-5-oxo-3-phenyl-2H-pyrrole-2-carboxamide |
| SMILES | CC(C)(C)NC(=O)C1C(c2ccccc2)=CC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C22H24N2O2/c1-22(2,3)23-21(26)20-18(17-12-8-5-9-13-17)14-19(25)24(20)15-16-10-6-4-7-11-16/h4-14,20H,15H2,1-3H3,(H,23,26) |
| InChIKey | FGNJSTYAYMKQAN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |