C28H26N2O3 — CID 71162127
8-benzyl-N-tert-butyl-9-oxo-5-oxa-8-azatetracyclo[8.8.0.02,6.013,18]octadeca-1(10),2(6),3,11,13,15,17-heptaene-7-carboxamide (PubChem CID 71162127) has the molecular formula C28H26N2O3 and a molecular weight of 438.53 g/mol. Its IUPAC name is 8-benzyl-N-tert-butyl-9-oxo-5-oxa-8-azatetracyclo[8.8.0.02,6.013,18]octadeca-1(10),2(6),3,11,13,15,17-heptaene-7-carboxamide.
| Compound Name | 8-benzyl-N-tert-butyl-9-oxo-5-oxa-8-azatetracyclo[8.8.0.02,6.013,18]octadeca-1(10),2(6),3,11,13,15,17-heptaene-7-carboxamide |
|---|---|
| PubChem CID | 71162127 |
| Molecular Formula | C28H26N2O3 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 8-benzyl-N-tert-butyl-9-oxo-5-oxa-8-azatetracyclo[8.8.0.02,6.013,18]octadeca-1(10),2(6),3,11,13,15,17-heptaene-7-carboxamide |
| SMILES | CC(C)(C)NC(=O)C1c2occc2-c2c(ccc3ccccc23)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C28H26N2O3/c1-28(2,3)29-26(31)24-25-21(15-16-33-25)23-20-12-8-7-11-19(20)13-14-22(23)27(32)30(24)17-18-9-5-4-6-10-18/h4-16,24H,17H2,1-3H3,(H,29,31) |
| InChIKey | BIOPMTXQXJQOJW-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |