C19H22N4O4 — CID 71162173
N-tert-butyl-7-[(4-methoxyphenyl)methyl]-5,6-dioxo-8H-imidazo[1,5-a]pyrazine-8-carboxamide (PubChem CID 71162173) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is N-tert-butyl-7-[(4-methoxyphenyl)methyl]-5,6-dioxo-8H-imidazo[1,5-a]pyrazine-8-carboxamide.
| Compound Name | N-tert-butyl-7-[(4-methoxyphenyl)methyl]-5,6-dioxo-8H-imidazo[1,5-a]pyrazine-8-carboxamide |
|---|---|
| PubChem CID | 71162173 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | N-tert-butyl-7-[(4-methoxyphenyl)methyl]-5,6-dioxo-8H-imidazo[1,5-a]pyrazine-8-carboxamide |
| SMILES | COc1ccc(CN2C(=O)C(=O)n3cncc3C2C(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H22N4O4/c1-19(2,3)21-16(24)15-14-9-20-11-23(14)18(26)17(25)22(15)10-12-5-7-13(27-4)8-6-12/h5-9,11,15H,10H2,1-4H3,(H,21,24) |
| InChIKey | NWWAJQBJUJAUNE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|