C16H20N2O7 — CID 164594921
(5R,6R,7S,8R,8aS)-6,7,8-trihydroxy-5-(hydroxymethyl)-1-[(4-methoxyphenyl)methyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,2-a]pyridine-2,3-dione (PubChem CID 164594921) has the molecular formula C16H20N2O7 and a molecular weight of 352.34 g/mol. Its IUPAC name is (5R,6R,7S,8R,8aS)-6,7,8-trihydroxy-5-(hydroxymethyl)-1-[(4-methoxyphenyl)methyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,2-a]pyridine-2,3-dione.
| Compound Name | (5R,6R,7S,8R,8aS)-6,7,8-trihydroxy-5-(hydroxymethyl)-1-[(4-methoxyphenyl)methyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,2-a]pyridine-2,3-dione |
|---|---|
| PubChem CID | 164594921 |
| Molecular Formula | C16H20N2O7 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | (5R,6R,7S,8R,8aS)-6,7,8-trihydroxy-5-(hydroxymethyl)-1-[(4-methoxyphenyl)methyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,2-a]pyridine-2,3-dione |
| SMILES | COc1ccc(CN2C(=O)C(=O)N3[C@H](CO)[C@@H](O)[C@H](O)[C@H](O)[C@@H]23)cc1 |
| InChI | InChI=1S/C16H20N2O7/c1-25-9-4-2-8(3-5-9)6-17-14-13(22)12(21)11(20)10(7-19)18(14)16(24)15(17)23/h2-5,10-14,19-22H,6-7H2,1H3/t10-,11-,12+,13+,14+/m1/s1 |
| InChIKey | HUPKODBCCXRFIP-DGTMBMJNSA-N |
| XLogP | -2.35 |
| TPSA | 130.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|