C22H26N2O3S — CID 134838501
(4E)-N-tert-butyl-4-ethylidene-6-[(4-methoxyphenyl)methyl]-5-oxo-7H-thieno[2,3-c]pyridine-7-carboxamide (PubChem CID 134838501) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is (4E)-N-tert-butyl-4-ethylidene-6-[(4-methoxyphenyl)methyl]-5-oxo-7H-thieno[2,3-c]pyridine-7-carboxamide.
| Compound Name | (4E)-N-tert-butyl-4-ethylidene-6-[(4-methoxyphenyl)methyl]-5-oxo-7H-thieno[2,3-c]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 134838501 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | (4E)-N-tert-butyl-4-ethylidene-6-[(4-methoxyphenyl)methyl]-5-oxo-7H-thieno[2,3-c]pyridine-7-carboxamide |
| SMILES | C/C=C1/C(=O)N(Cc2ccc(OC)cc2)C(C(=O)NC(C)(C)C)c2sccc21 |
| InChI | InChI=1S/C22H26N2O3S/c1-6-16-17-11-12-28-19(17)18(20(25)23-22(2,3)4)24(21(16)26)13-14-7-9-15(27-5)10-8-14/h6-12,18H,13H2,1-5H3,(H,23,25)/b16-6+ |
| InChIKey | DOMGPCIXMNTYKK-OMCISZLKSA-N |
| XLogP | 4.16 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|