C26H27N3O3S — CID 46868740
N-tert-butyl-2,5-dioxo-7-phenyl-4-(2-phenylethyl)-1,3-dihydrothieno[2,3-e][1,4]diazepine-3-carboxamide (PubChem CID 46868740) has the molecular formula C26H27N3O3S and a molecular weight of 461.59 g/mol. Its IUPAC name is N-tert-butyl-2,5-dioxo-7-phenyl-4-(2-phenylethyl)-1,3-dihydrothieno[2,3-e][1,4]diazepine-3-carboxamide.
| Compound Name | N-tert-butyl-2,5-dioxo-7-phenyl-4-(2-phenylethyl)-1,3-dihydrothieno[2,3-e][1,4]diazepine-3-carboxamide |
|---|---|
| PubChem CID | 46868740 |
| Molecular Formula | C26H27N3O3S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | N-tert-butyl-2,5-dioxo-7-phenyl-4-(2-phenylethyl)-1,3-dihydrothieno[2,3-e][1,4]diazepine-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)C1C(=O)Nc2sc(-c3ccccc3)cc2C(=O)N1CCc1ccccc1 |
| InChI | InChI=1S/C26H27N3O3S/c1-26(2,3)28-23(31)21-22(30)27-24-19(16-20(33-24)18-12-8-5-9-13-18)25(32)29(21)15-14-17-10-6-4-7-11-17/h4-13,16,21H,14-15H2,1-3H3,(H,27,30)(H,28,31) |
| InChIKey | RIPCTEOHSGSBTE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|