C41H45NO9 — CID 122392400
N-[(2S,3R,4R,5S,6R)-4,5-bis(phenylmethoxy)-2-[[(1R,2R,5R,6R)-2-phenylmethoxy-3,7-dioxabicyclo[4.1.0]heptan-5-yl]oxy]-6-(phenylmethoxymethyl)oxan-3-yl]acetamide (PubChem CID 122392400) has the molecular formula C41H45NO9 and a molecular weight of 695.81 g/mol. Its IUPAC name is N-[(2S,3R,4R,5S,6R)-4,5-bis(phenylmethoxy)-2-[[(1R,2R,5R,6R)-2-phenylmethoxy-3,7-dioxabicyclo[4.1.0]heptan-5-yl]oxy]-6-(phenylmethoxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[(2S,3R,4R,5S,6R)-4,5-bis(phenylmethoxy)-2-[[(1R,2R,5R,6R)-2-phenylmethoxy-3,7-dioxabicyclo[4.1.0]heptan-5-yl]oxy]-6-(phenylmethoxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 122392400 |
| Molecular Formula | C41H45NO9 |
| Molecular Weight | 695.81 g/mol |
| Exact Mass | 695.31 |
| IUPAC Name | N-[(2S,3R,4R,5S,6R)-4,5-bis(phenylmethoxy)-2-[[(1R,2R,5R,6R)-2-phenylmethoxy-3,7-dioxabicyclo[4.1.0]heptan-5-yl]oxy]-6-(phenylmethoxymethyl)oxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@H]1[C@H](O[C@@H]2CO[C@@H](OCc3ccccc3)[C@@H]3O[C@@H]32)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C41H45NO9/c1-28(43)42-35-38(46-24-31-18-10-4-11-19-31)36(45-23-30-16-8-3-9-17-30)33(26-44-22-29-14-6-2-7-15-29)49-40(35)50-34-27-48-41(39-37(34)51-39)47-25-32-20-12-5-13-21-32/h2-21,33-41H,22-27H2,1H3,(H,42,43)/t33-,34-,35-,36-,37-,38-,39-,40+,41-/m1/s1 |
| InChIKey | HDTNXXJTZISFIN-SMZVEZEISA-N |
| XLogP | 5.33 |
| TPSA | 106.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.81 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|