C74H104NO+ — CID 122394915
[3,5-bis[4,5-bis(2-ethylhexyl)anthracen-9-yl]-4-methoxyphenyl]methyl-triethylazanium (PubChem CID 122394915) has the molecular formula C74H104NO+ and a molecular weight of 1023.65 g/mol. Its IUPAC name is [3,5-bis[4,5-bis(2-ethylhexyl)anthracen-9-yl]-4-methoxyphenyl]methyl-triethylazanium.
| Compound Name | [3,5-bis[4,5-bis(2-ethylhexyl)anthracen-9-yl]-4-methoxyphenyl]methyl-triethylazanium |
|---|---|
| PubChem CID | 122394915 |
| Molecular Formula | C74H104NO+ |
| Molecular Weight | 1023.65 g/mol |
| Exact Mass | 1022.81 |
| IUPAC Name | [3,5-bis[4,5-bis(2-ethylhexyl)anthracen-9-yl]-4-methoxyphenyl]methyl-triethylazanium |
| SMILES | CCCCC(CC)Cc1cccc2c(-c3cc(C[N+](CC)(CC)CC)cc(-c4c5cccc(CC(CC)CCCC)c5cc5c(CC(CC)CCCC)cccc45)c3OC)c3cccc(CC(CC)CCCC)c3cc12 |
| InChI | InChI=1S/C74H104NO/c1-13-24-32-53(17-5)44-58-36-28-40-62-66(58)50-67-59(45-54(18-6)33-25-14-2)37-29-41-63(67)72(62)70-48-57(52-75(21-9,22-10)23-11)49-71(74(70)76-12)73-64-42-30-38-60(46-55(19-7)34-26-15-3)68(64)51-69-61(39-31-43-65(69)73)47-56(20-8)35-27-16-4/h28-31,36-43,48-51,53-56H,13-27,32-35,44-47,52H2,1-12H3/q+1 |
| InChIKey | ALSKYKMRRJIBMA-UHFFFAOYSA-N |
| XLogP | 22.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1023.65 |
| LogP ≤ 5 | 22.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|