C68H88O3 — CID 132838971
[2,6-bis[4,5-bis(2-ethylhexyl)anthracen-9-yl]-4-hydroxyphenyl] acetate (PubChem CID 132838971) has the molecular formula C68H88O3 and a molecular weight of 953.45 g/mol. Its IUPAC name is [2,6-bis[4,5-bis(2-ethylhexyl)anthracen-9-yl]-4-hydroxyphenyl] acetate.
| Compound Name | [2,6-bis[4,5-bis(2-ethylhexyl)anthracen-9-yl]-4-hydroxyphenyl] acetate |
|---|---|
| PubChem CID | 132838971 |
| Molecular Formula | C68H88O3 |
| Molecular Weight | 953.45 g/mol |
| Exact Mass | 952.67 |
| IUPAC Name | [2,6-bis[4,5-bis(2-ethylhexyl)anthracen-9-yl]-4-hydroxyphenyl] acetate |
| SMILES | CCCCC(CC)Cc1cccc2c(-c3cc(O)cc(-c4c5cccc(CC(CC)CCCC)c5cc5c(CC(CC)CCCC)cccc45)c3OC(C)=O)c3cccc(CC(CC)CCCC)c3cc12 |
| InChI | InChI=1S/C68H88O3/c1-10-18-26-47(14-5)38-51-30-22-34-56-60(51)44-61-52(39-48(15-6)27-19-11-2)31-23-35-57(61)66(56)64-42-55(70)43-65(68(64)71-46(9)69)67-58-36-24-32-53(40-49(16-7)28-20-12-3)62(58)45-63-54(33-25-37-59(63)67)41-50(17-8)29-21-13-4/h22-25,30-37,42-45,47-50,70H,10-21,26-29,38-41H2,1-9H3 |
| InChIKey | YQAWNZKHEIHQAM-UHFFFAOYSA-N |
| XLogP | 20.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 953.45 |
| LogP ≤ 5 | 20.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|