C26H42O6 — CID 66702448
bis(2-ethylhexyl) 2-[(2,3-dihydroxyphenyl)methyl]propanedioate (PubChem CID 66702448) has the molecular formula C26H42O6 and a molecular weight of 450.62 g/mol. Its IUPAC name is bis(2-ethylhexyl) 2-[(2,3-dihydroxyphenyl)methyl]propanedioate.
| Compound Name | bis(2-ethylhexyl) 2-[(2,3-dihydroxyphenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 66702448 |
| Molecular Formula | C26H42O6 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | bis(2-ethylhexyl) 2-[(2,3-dihydroxyphenyl)methyl]propanedioate |
| SMILES | CCCCC(CC)COC(=O)C(Cc1cccc(O)c1O)C(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C26H42O6/c1-5-9-12-19(7-3)17-31-25(29)22(16-21-14-11-15-23(27)24(21)28)26(30)32-18-20(8-4)13-10-6-2/h11,14-15,19-20,22,27-28H,5-10,12-13,16-18H2,1-4H3 |
| InChIKey | IMWATNURLDFQGA-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|