C18H31NO4Si — CID 122395221
tert-butyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethynyl-6-oxopiperidine-1-carboxylate (PubChem CID 122395221) has the molecular formula C18H31NO4Si and a molecular weight of 353.54 g/mol. Its IUPAC name is tert-butyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethynyl-6-oxopiperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethynyl-6-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 122395221 |
| Molecular Formula | C18H31NO4Si |
| Molecular Weight | 353.54 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | tert-butyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethynyl-6-oxopiperidine-1-carboxylate |
| SMILES | C#C[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CCC(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H31NO4Si/c1-10-13-14(23-24(8,9)18(5,6)7)11-12-15(20)19(13)16(21)22-17(2,3)4/h1,13-14H,11-12H2,2-9H3/t13-,14+/m1/s1 |
| InChIKey | MCHIVTQEZPKOTE-KGLIPLIRSA-N |
| XLogP | 3.94 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.54 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|