C22H32O4 — CID 122395529
(1R,5S,6S,8R)-5-[(4S)-4-[(4-methoxyphenyl)methoxy]pentyl]-4,11-dioxatricyclo[6.2.1.01,6]undecane (PubChem CID 122395529) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is (1R,5S,6S,8R)-5-[(4S)-4-[(4-methoxyphenyl)methoxy]pentyl]-4,11-dioxatricyclo[6.2.1.01,6]undecane.
| Compound Name | (1R,5S,6S,8R)-5-[(4S)-4-[(4-methoxyphenyl)methoxy]pentyl]-4,11-dioxatricyclo[6.2.1.01,6]undecane |
|---|---|
| PubChem CID | 122395529 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (1R,5S,6S,8R)-5-[(4S)-4-[(4-methoxyphenyl)methoxy]pentyl]-4,11-dioxatricyclo[6.2.1.01,6]undecane |
| SMILES | COc1ccc(CO[C@@H](C)CCC[C@@H]2OCC[C@]34CC[C@H](C[C@@H]23)O4)cc1 |
| InChI | InChI=1S/C22H32O4/c1-16(25-15-17-6-8-18(23-2)9-7-17)4-3-5-21-20-14-19-10-11-22(20,26-19)12-13-24-21/h6-9,16,19-21H,3-5,10-15H2,1-2H3/t16-,19+,20-,21-,22+/m0/s1 |
| InChIKey | OJJREYGTMQMDHW-WWOGRVQXSA-N |
| XLogP | 4.50 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |