C32H28O4 — CID 122395661
benzhydryl (E,2S)-2-hydroxy-4-(4-methylphenyl)-2-phenacylbut-3-enoate (PubChem CID 122395661) has the molecular formula C32H28O4 and a molecular weight of 476.57 g/mol. Its IUPAC name is benzhydryl (E,2S)-2-hydroxy-4-(4-methylphenyl)-2-phenacylbut-3-enoate.
| Compound Name | benzhydryl (E,2S)-2-hydroxy-4-(4-methylphenyl)-2-phenacylbut-3-enoate |
|---|---|
| PubChem CID | 122395661 |
| Molecular Formula | C32H28O4 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | benzhydryl (E,2S)-2-hydroxy-4-(4-methylphenyl)-2-phenacylbut-3-enoate |
| SMILES | Cc1ccc(/C=C/[C@@](O)(CC(=O)c2ccccc2)C(=O)OC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H28O4/c1-24-17-19-25(20-18-24)21-22-32(35,23-29(33)26-11-5-2-6-12-26)31(34)36-30(27-13-7-3-8-14-27)28-15-9-4-10-16-28/h2-22,30,35H,23H2,1H3/b22-21+/t32-/m1/s1 |
| InChIKey | ZZQORRAXNOACDY-RANXHWDDSA-N |
| XLogP | 6.35 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |