C31H26O4 — CID 122395667
benzhydryl (E,2S)-2-hydroxy-2-phenacyl-4-phenylbut-3-enoate (PubChem CID 122395667) has the molecular formula C31H26O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is benzhydryl (E,2S)-2-hydroxy-2-phenacyl-4-phenylbut-3-enoate.
| Compound Name | benzhydryl (E,2S)-2-hydroxy-2-phenacyl-4-phenylbut-3-enoate |
|---|---|
| PubChem CID | 122395667 |
| Molecular Formula | C31H26O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | benzhydryl (E,2S)-2-hydroxy-2-phenacyl-4-phenylbut-3-enoate |
| SMILES | O=C(C[C@](O)(/C=C/c1ccccc1)C(=O)OC(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H26O4/c32-28(25-15-7-2-8-16-25)23-31(34,22-21-24-13-5-1-6-14-24)30(33)35-29(26-17-9-3-10-18-26)27-19-11-4-12-20-27/h1-22,29,34H,23H2/b22-21+/t31-/m1/s1 |
| InChIKey | BQJAOCKJNHTRKB-QOCKYVPWSA-N |
| XLogP | 6.04 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |